You have no items in your shopping cart.
Cart summary
Entecavir monohydrate
Catalog Number: orb1310955
| Catalog Number | orb1310955 |
|---|---|
| Category | Small Molecules |
| Description | Entecavir monohydrate |
| CAS Number | 209216-23-9 |
| Purity | 100.00% |
| MW | 295.3 |
| SMILES | O.Nc1nc(=O)c2ncn([C@H]3C[C@H](O)[C@@H](CO)C3=C)c2[nH]1 |
| Formula | C12H17N5O4 |
| Biological Activity | Entecavir monohydrate (BMS-200475) is a selective inhibitor of the replication of the hepatitis B virus (HBV). It, a new deoxyguanine nucleoside analog. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
