You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1300973 |
---|---|
Category | Small Molecules |
Description | Emtricitabine |
CAS Number | 143491-57-0 |
Purity | 99.93% |
MW | 247.25 |
SMILES | Nc1nc(=O)n(cc1F)[C@@H]1CS[C@H](CO)O1 |
Formula | C8H10FN3O3S |
Biological Activity | Emtricitabine (FTC) (FTC), a nucleoside reverse transcriptase inhibitor, exhibits inhibition activity against human immunodeficiency virus (HIV) and hepatitis B virus. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
[143491-57-0] | |
247.25 | |
C8H10FN3O3S |
98.00% | |
1188407-46-6 | |
575.11 | |
C8H9FN3Na4O12P3S |