You have no items in your shopping cart.
Cart summary
Item 1 of 1
Eleutheroside B
Catalog Number: orb104633
| Catalog Number | orb104633 |
|---|---|
| Category | Small Molecules |
| Description | Eleutheroside B |
| CAS Number | [118-34-3] |
| Purity | > 98%,Standard References |
| MW | 372.37 |
| SMILES | COC1=CC(/C=C/CO)=CC(OC)=C1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O |
| Formula | C17H24O9 |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
Chemical structure of Eleutheroside B
