You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb134867 |
---|---|
Category | Small Molecules |
Description | Drospirenone is a synthetic progestogen exhibiting antiandrogenic and antimineralocorticoid activity. |
CAS Number | [67392-87-4] |
MW | 366.4932 |
SMILES | O1C(C([H])([H])C([H])([H])[C@@]21[C@@]1(C([H])([H])[H])C([H])([H])C([H])([H])[C@]3([H])[C@@]4(C([H])([H])[H])C([H])([H])C([H])([H])C(C([H])=C4[C@]4([H])C([H])([H])[C@]4([H])[C@@]3([H])[C@]1([H])[C@]1([H])C([H])([H])[C@@]12[H])=O)=O |
Formula | C24H30O3 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
Chemical structure of Drospirenone
98.00% | |
164017-31-6 | |
662.90 | |
C44H54O5 |
99.81% | |
67392-87-4 | |
366.49 | |
C24H30O3 |