You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb154633 |
---|---|
Category | Small Molecules |
Description | Donepezil is a specific and potent AChE inhibitor for bAChE and hAChE with IC50 of 8.12 nM and 11.6 nM , respectively. |
CAS Number | [120011-70-3] |
MW | 415.95 |
SMILES | O=C1C(CC2CCN(CC3=CC=CC=C3)CC2)CC4=C1C=C(OC)C(OC)=C4.[H]Cl |
Formula | C24H30ClNO3 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
Donepezil hydrochloride chemical structure
99.96% | |
120013-39-0 | |
325.83 | |
C17H24ClNO3 |
98% | |
1034439-57-0 | |
401.98 | |
C24H32ClNO2 |
99.55% | |
120011-70-3 | |
415.96 | |
C24H30ClNO3 |