You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1300734 |
---|---|
Category | Small Molecules |
Description | Donepezil Hydrochloride |
CAS Number | 120011-70-3 |
Purity | 99.55% |
MW | 415.96 |
SMILES | Cl.O=C1C2=CC(OC)=C(OC)C=C2CC1CC3CCN(CC=4C=CC=CC4)CC3 |
Formula | C24H30ClNO3 |
Biological Activity | Donepezil HCl(Aricept) is a selective and effective AChE inhibitor for bAChE and hAChE (IC50: 8.12/11.6 nM). |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
[120011-70-3] | |
415.95 | |
C24H30ClNO3 |
99.96% | |
120013-39-0 | |
325.83 | |
C17H24ClNO3 |
98% | |
1034439-57-0 | |
401.98 | |
C24H32ClNO2 |