You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb692140 |
---|---|
Category | Small Molecules |
Description | Diisononyl phthalate (DINP) is a phthalate used as a plasticizer. DINP is typically a mixture of chemical compounds consisting of various isononyl esters of phthalic acid. |
CAS Number | [28553-12-0] |
MW | 418.61 |
SMILES | O=C(C1=CC=CC=C1C(OCCCCCCC(C)C)=O)OCCCCCCC(C)C |
Formula | C26H42O4 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
28553-12-0 | |
418.61 | |
C26H42O4 |
Filter by Rating