You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1303378 |
---|---|
Category | Small Molecules |
Description | Dihydrolycorine |
CAS Number | 6271-21-2 |
Purity | 99.20% |
MW | 289.33 |
SMILES | [H][C@@]12CCN3Cc4cc5OCOc5cc4[C@]([H])([C@H](O)[C@@H](O)C1)[C@@]23[H] |
Formula | C16H19NO4 |
Biological Activity | 1. Dihydrolycorine-HCL(DL) shows hypotensive effects, it can block alpha 1-adrenoceptors. 2. Dihydrolycorine is an inhibitors of protein synthesis in eukarytic cells, it halts protein synthesis in eukaryotic cells by inhibiting the peptide bone formation step. 3. Dihydrolycorine and nimodipine protects against anoxia damage of brain in rat. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |