You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb611498 |
---|---|
Category | Small Molecules |
Description | A derivative of EDTA that chelates iron and reduces the number of metal ions complexed with anthracycline and, consequently, decrease the formation of superoxide radicals. |
CAS Number | [24584-09-6] |
MW | 268.2691 |
SMILES | O=C1CN(CC(=O)N1)C[C@H](C)N2CC(=O)NC(=O)C2 |
Formula | C11H16N4O4 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.80% | |
149003-01-0 | |
304.73 | |
C11H16N4O4·HCl |
99.45% | |
24584-09-6 | |
268.27 | |
C11H16N4O4 |