You have no items in your shopping cart.
Cart summary
Dexpramipexole dihydrochloride
Catalog Number: orb1309770
| Catalog Number | orb1309770 |
|---|---|
| Category | Small Molecules |
| Description | Dexpramipexole dihydrochloride |
| CAS Number | 104632-27-1 |
| Purity | 99.88% |
| MW | 284.25 |
| SMILES | Cl.Cl.CCCNC1CCc2nc(N)sc2C1 |
| Formula | C10H19Cl2N3S |
| Biological Activity | Dexpramipexole dihydrochloride (KNS-760704 dihydrochloride) ((R)-Pramipexole dihydrochloride) is a neuroprotective agent and is a weak non-ergoline dopamine agonist. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
