You have no items in your shopping cart.
Cart summary
Desethyl-etomidate
Catalog Number: orb1697479
| Catalog Number | orb1697479 |
|---|---|
| Category | Small Molecules |
| Description | Desethyl-etomidate |
| CAS Number | 56649-48-0 |
| Purity | 98% |
| MW | 216.24 |
| SMILES | [C@H](C)(N1C(C(O)=O)=CN=C1)C2=CC=CC=C2 |
| Formula | C12H12N2O2 |
| Biological Activity | Desethyl-etomidate is a biochemical. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
