You have no items in your shopping cart.
Cart summary
Demethoxy Curcumin-d4
Catalog Number: orb2280966
| Catalog Number | orb2280966 |
|---|---|
| Category | Small Molecules |
| Description | Demethoxy Curcumin-d4 is a deuterated compound of Demethoxy Curcumin. Demethoxy Curcumin has a CAS number of 22608-11-3. 1. Demethoxycurcumin has antioxidant activity. 2. Demethoxycurcumin has anti-inflammatory activity. 3. Demethoxycurcumin has anti-proliferative activity. 4. Demethoxycurcumin has anti-acanthamoebic effect. 5. Demethoxycurcumin is a potential additive natural product in combination with chemotherapeutic agents in drug-resistant cancers. 6. Demethoxycurcumin inhibits energy metabolic and oncogenic signaling pathways through AMPK activation in triple-negative breast cancer cells. |
| Purity | 98.00% |
| MW | 342.38 |
| SMILES | O=C(CC(/C=C/C1=C([2H])C([2H])=C(O)C([2H])=C1[2H])=O)/C=C/C2=CC=C(O)C(OC)=C2 |
| Formula | C20H14D4O5 |
| Biological Activity | Demethoxy Curcumin-d4 is a deuterated compound of Demethoxy Curcumin. Demethoxy Curcumin has a CAS number of 22608-11-3. 1. Demethoxycurcumin has antioxidant activity. 2. Demethoxycurcumin has anti-inflammatory activity. 3. Demethoxycurcumin has anti-proliferative activity. 4. Demethoxycurcumin has anti-acanthamoebic effect. 5. Demethoxycurcumin is a potential additive natural product in combination with chemotherapeutic agents in drug-resistant cancers. 6. Demethoxycurcumin inhibits energy metabolic and oncogenic signaling pathways through AMPK activation in triple-negative breast cancer cells. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
