You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1089483 |
---|---|
Category | Small Molecules |
Description | Novel proteasome inhibitor, inducing human myeloid tumor-selective apoptosis |
CAS Number | [187585-11-1] |
MW | 282.29396 |
SMILES | COC1=C(N)C=C(C=C1)C2=C(N)C(=O)C3C(=CC=CC=3)O2 |
Formula | C16H14N2O3 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
ICC, IHC, IHC-P, WB | |
Human, Mouse | |
Rabbit | |
Polyclonal | |
Unconjugated |
IHC, WB | |
Bovine, Canine, Equine, Guinea pig, Mouse, Rabbit, Rat, Sheep | |
Human, Monkey | |
Rabbit | |
Polyclonal | |
Unconjugated |
Filter by Rating