You have no items in your shopping cart.
Cart summary
D-Galacturonic acid monohydrate
Catalog Number: orb1984130
| Catalog Number | orb1984130 |
|---|---|
| Category | Small Molecules |
| Description | D-Galacturonic acid monohydrate is a natural product. |
| CAS Number | 685-73-4 |
| Purity | 98.00% |
| MW | 194.14 |
| SMILES | [C@@H]([C@@H]([C@H](C=O)O)O)([C@@H](C(O)=O)O)O |
| Formula | C6H10O7 |
| Biological Activity | D-Galacturonic acid monohydrate is a natural product. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
