You have no items in your shopping cart.
Cart summary
Cridanimod sodium
Catalog Number: orb1689903
| Catalog Number | orb1689903 |
|---|---|
| Category | Small Molecules |
| Description | Cridanimod sodium |
| CAS Number | 58880-43-6 |
| Purity | 98% |
| MW | 276.24 |
| SMILES | [Na+].[O-]C(=O)CN1C2=C(C=CC=C2)C(=O)C2=C1C=CC=C2 |
| Formula | C15H11NNaO3 |
| Biological Activity | Cridanimod can increase progesterone receptor (PR) expression, with potential antineoplastic adjuvant activity. Cridanimod is able to induce the expression of PR in endometrial cancer. In combination with a progestin, cancer cells could be eradicated through increased PR-mediated signaling, leading to an inhibition of luteinizing hormone release from the pituitary gland, via a negative feedback mechanism, and, eventually, an inhibition of estrogen released from the ovaries. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
