You have no items in your shopping cart.
Cart summary
Cridanimod
Catalog Number: orb1301895
| Catalog Number | orb1301895 |
|---|---|
| Category | Small Molecules |
| Description | Cridanimod |
| CAS Number | 38609-97-1 |
| Purity | 99.96% |
| MW | 253.25 |
| SMILES | OC(=O)CN1C2=C(C=CC=C2)C(=O)C2=C1C=CC=C2 |
| Formula | C15H11NO3 |
| Biological Activity | Cridanimod (10-carboxymethyl-9-acridanone, CMA) is a potent STING agonist that directly binds to STING and triggers a strong antiviral response through the TBK1/IRF3 route. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
