You have no items in your shopping cart.
Cart summary
Coptisine sulfate
Catalog Number: orb1302372
| Catalog Number | orb1302372 |
|---|---|
| Category | Small Molecules |
| Description | Coptisine sulfate |
| CAS Number | 1198398-71-8 |
| Purity | 98% |
| MW | 417.39 |
| SMILES | OS([O-])(=O)=O.C1Oc2cc3CC[n+]4cc5c6OCOc6ccc5cc4-c3cc2O1 |
| Formula | C19H15NO8S |
| Biological Activity | 1. Coptisine sulfate has growth inhibitory activity against human cancer cell line in the NCI's anticancer drug screening program. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
