You have no items in your shopping cart.
Cart summary
Coptisine chloride
Catalog Number: orb1301353
| Catalog Number | orb1301353 |
|---|---|
| Category | Small Molecules |
| Description | Coptisine chloride |
| CAS Number | 6020-18-4 |
| Purity | 98.85% |
| MW | 355.77 |
| SMILES | [Cl-].C1Oc2cc3CC[n+]4cc5c6OCOc6ccc5cc4-c3cc2O1 |
| Formula | C19H14ClNO4 |
| Biological Activity | 1. Coptisine chloride (NSC-119754) can be absorbed across intestinal epithelial cells, and completely absorbed compounds. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
- Item 1 of 1
