You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1981789 |
---|---|
Category | Small Molecules |
Description | (±)-Columbianetin |
CAS Number | 1147-29-1 |
MW | 246.26 |
SMILES | CC(C)(O)C1Cc2c(O1)ccc1ccc(=O)oc21 |
Formula | C14H14O4 |
Biological Activity | Columbianetin, a phytoalexin found in celery (Apium graveolens), plays a crucial role in the plant's resistance to pathogens during storage. It demonstrates significant anti-fungal and anti-inflammatory properties [1] [2]. |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
52842-47-4 | |
246.262 | |
C14H14O4 |
Filter by Rating