You have no items in your shopping cart.
Cart summary
Columbamine chloride
Catalog Number: orb1942076
| Catalog Number | orb1942076 |
|---|---|
| Category | Small Molecules |
| Description | Columbamine chloride, also known as Columbamin and Dehydroisocorypalmine, is an alkaloid [1]. |
| CAS Number | 1916-10-5 |
| Purity | 98.00% |
| MW | 373.83 |
| SMILES | [Cl-].OC=1C=C2C=3C=C4C=CC(OC)=C(OC)C4=C[N+]3CCC2=CC1OC |
| Formula | C20H20ClNO4 |
| Biological Activity | Columbamine chloride, also known as Columbamin and Dehydroisocorypalmine, is an alkaloid [1]. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
