You have no items in your shopping cart.
Cart summary
Colletochlorin B
Catalog Number: orb1986257
| Catalog Number | orb1986257 |
|---|---|
| Category | Small Molecules |
| Description | Colletochlorin B is a natural differentiation inducer of human promyelocytic leukemia cells. |
| CAS Number | 83324-48-5 |
| Purity | 98.00% |
| MW | 322.83 |
| SMILES | C(/C=C(/CCC=C(C)C)\C)C1=C(O)C(C=O)=C(C)C(Cl)=C1O |
| Formula | C18H23ClO3 |
| Biological Activity | Colletochlorin B is a natural differentiation inducer of human promyelocytic leukemia cells. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
