You have no items in your shopping cart.
Cart summary
Colistin A
Catalog Number: orb1987100
| Catalog Number | orb1987100 |
|---|---|
| Category | Small Molecules |
| Description | Colistin A is an antibiotic generated by certain strains of the bacteria Paenibacillus polymyxa. Colistin is a mixture of the cyclic polypeptides colistin A and B and belongs to the class of polypeptide antibiotics known as polymyxins. Colistin is effective against most Gram-negative bacilli. |
| CAS Number | 7722-44-3 |
| Purity | 98.00% |
| MW | 1169.46 |
| SMILES | N(C([C@@H](NC([C@@H](NC([C@@H](NC(CCCC[C@H](CC)C)=O)CCN)=O)[C@@H](C)O)=O)CCN)=O)[C@@H]1C(=O)N[C@@H](CCN)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCN)C(=O)N[C@@H](CCN)C(=O)N[C@@]([C@@H](C)O)(C(=O)NCC1)[H] |
| Formula | C53H100N16O13 |
| Biological Activity | Colistin A is an antibiotic generated by certain strains of the bacteria Paenibacillus polymyxa. Colistin is a mixture of the cyclic polypeptides colistin A and B and belongs to the class of polypeptide antibiotics known as polymyxins. Colistin is effective against most Gram-negative bacilli. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
