You have no items in your shopping cart.
Cart summary
CK-636
Catalog Number: orb1307381
| Catalog Number | orb1307381 |
|---|---|
| Category | Small Molecules |
| Description | CK-636 |
| CAS Number | 442632-72-6 |
| Purity | 98.88% |
| MW | 284.38 |
| SMILES | Cc1[nH]c2ccccc2c1CCNC(=O)c1cccs1 |
| Formula | C16H16N2OS |
| Biological Activity | CK-636 (CK-0944636), an Arp2/3 complex inhibitor, can inhibit actin polymerization induced by the human (IC50: 4 μM), fission yeast (IC50: 24 μM) and bovine (IC50: 32 μM) Arp2/3 complex, respectively. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
