You have no items in your shopping cart.
Cart summary
cis-Nerolidol
Catalog Number: orb2278585
| Catalog Number | orb2278585 |
|---|---|
| Category | Small Molecules |
| Description | cis-Nerolidol, a sesquiterpene alcohol present in numerous plants, exhibits antioxidant and antibacterial properties. Additionally, it can potentiate the effects of antibiotics [1]. |
| CAS Number | 3790-78-1 |
| Purity | 98.00% |
| MW | 222.37 |
| SMILES | C(\CCC(C=C)(C)O)=C(\CCC=C(C)C)/C |
| Formula | C15H26O |
| Biological Activity | cis-Nerolidol, a sesquiterpene alcohol present in numerous plants, exhibits antioxidant and antibacterial properties. Additionally, it can potentiate the effects of antibiotics [1]. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
