You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb104517 |
---|---|
Category | Small Molecules |
Description | Cineole |
CAS Number | [470-82-6] |
Purity | > 98%,Standard References |
MW | 154.25 |
SMILES | C[C@]1(CC2)OC(C)(C)[C@]2([H])CC1 |
Formula | C10H18O |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
Chemical structure of Cineole
IF, IH, WB | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
FC, IF, IHC-Fr, IHC-P, WB | |
Bovine, Canine, Guinea pig, Mouse, Porcine, Rabbit | |
Human, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |