You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb572979 |
---|---|
Category | Small Molecules |
Description | ChX710 could prime the type I interferon response to cytosolic DNA, which induces the ISRE promoter sequence, specific cellular Interferon-Stimulated Genes (ISGs), and the phosphorylation of Interferon Regulatory Factor (IRF) 3. |
CAS Number | [2438721-44-7] |
MW | 323.392243146896 |
SMILES | O=C(C1=CC=CC2=C1N=C(C1C=CN=CC=1)N2)NC(C)CN(C)C |
Formula | C18H21N5O |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.83% | |
2438721-44-7 | |
323.39 | |
C18H21N5O |