You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb573374 |
---|---|
Category | Small Molecules |
Description | Cefoxitin is a beta-lactam, second-generation cephalosporin antibiotic with bactericidal activity. |
CAS Number | [35607-66-0] |
MW | 427.45 |
SMILES | NC(OCC1CSC2[C@](C(=O)N2C=1C(=O)O)(OC)NC(CC1=CC=CS1)=O)=O |
Formula | C16H17N3O7S2 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.19% | |
33564-30-6 | |
449.43 | |
C16H16N3NaO7S2 |
99.80% | |
35607-66-0 | |
427.45 | |
C16H17N3O7S2 |