You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb154663 |
---|---|
Category | Small Molecules |
Description | Canertinib dihydrochloride is the hydrochloride salt of an orally bio-available quinazoline with potential antineoplastic and radiosensitizing activities. |
CAS Number | [289499-45-2] |
MW | 558.8603 |
SMILES | ClC1=C(C([H])=C([H])C(=C1[H])N([H])C1C2=C([H])C(=C(C([H])=C2N=C([H])N=1)OC([H])([H])C([H])([H])C([H])([H])N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H])N([H])C(C([H])=C([H])[H])=O)F.Cl[H].Cl[H] |
Formula | C24H27CL3FN5O3 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
Chemical structure of Canertinib dihydrochloride
≥98% | |
289499-45-2 | |
558.86 | |
C24H23ClFN5O3 2HCl |
99.23% | |
289499-45-2 | |
558.86 | |
C24H27Cl3FN5O3 |