You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb525630 |
---|---|
Category | Small Molecules |
Description | Calicheamicin, also known as Calicheamicin gamma(1,I) or Calichemicin gamma1, is an potent enediyne antitumor antibiotics derived from the bacterium Micromonospora echinospora. Calicheamicin targets DNA and cause strand scission. Calicheamicin binds with DNA in the minor groove, wherein it then undergos a reaction analogous to the Bergman cyclization to generate a diradical species. This diradical, 1,4-didehydrobenzene, then abstracts hydrogen atoms from the deoxyribose (sugar) backbone of DNA, which ultimately leads to strand scission. The specificity of binding of calicheamicin to the minor groove of DNA is due to the aryltetrasaccharide group of the molecule. |
CAS Number | [108212-75-5] |
MW | 1368.34756 |
SMILES | O=C(S[C@@H]1[C@@H](C)O[C@@H](ON[C@@H]2[C@@H](C)OC(O[C@@H](C#C/C=C\C#C[C@@]3(O)C4)C(/C3=C\CSSSC)=C(NC(OC)=O)C4=O)[C@H](O[C@H]5C[C@H](OC)[C@@H](NCC)CO5)[C@H]2O)C[C@@H]1O)C6=C(OC)C(OC)=C(O[C@H]7[C@H](O)[C@H](OC)[C@@H](O)[C@H](C)O7)C(I)=C6C |
Formula | C55H74N3O21S4I |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98% | |
108212-76-6 | |
1410.38 | |
C57H76IN3O22S4 |