You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1305297 |
---|---|
Category | Small Molecules |
Description | Cabozantinib |
CAS Number | 849217-68-1 |
Purity | 99.88% |
MW | 501.51 |
SMILES | O=C(NC1=CC=C(F)C=C1)C2(C(=O)NC3=CC=C(OC=4C=CN=C5C=C(OC)C(OC)=CC54)C=C3)CC2 |
Formula | C28H24FN3O5 |
Biological Activity | Cabozantinib (XL184) is a multi-targeted tyrosine kinase receptor inhibitor that inhibits VEGFR2, c-Met, Kit, Axl, and Flt3 (IC50=0.035/1.3/4.6/7/11.3 nM). Cabozantinib exhibits both antitumor and antiangiogenic activity. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
[1140909-48-3] | |
635.593 | |
C32H30FN3O10 |
99.72% | |
1817759-42-4 | |
537.96 | |
C28H25ClFN3O5 |
98.87% | |
1140909-48-3 | |
635.59 | |
C32H30FN3O10 |