You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1705106 |
---|---|
Category | Small Molecules |
Description | Butenafine |
CAS Number | 101828-21-1 |
Purity | 98% |
MW | 317.47 |
SMILES | C=1C=CC2=C(C1)C=CC=C2CN(C)CC3=CC=C(C=C3)C(C)(C)C |
Formula | C23H27N |
Biological Activity | Butenafine hydrochloride is a hydrochloride of butenafine, which inhibits squalene epoxidase to inhibit the synthesis of ergosterol, leading to the increased permeability of the cell membranes, allowing their contents to leak out. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.90% | |
101827-46-7 | |
353.93 | |
C23H28ClN |