You have no items in your shopping cart.
Cart summary
Butenafine hydrochloride
Catalog Number: orb1309359
| Catalog Number | orb1309359 |
|---|---|
| Category | Small Molecules |
| Description | Butenafine hydrochloride |
| CAS Number | 101827-46-7 |
| Purity | 99.90% |
| MW | 353.93 |
| SMILES | Cl.C(c1ccc(cc1)CN(C)Cc1cccc2c1cccc2)(C)(C)C |
| Formula | C23H28ClN |
| Biological Activity | Butenafine hydrochloride (KP363 Hydrochloride) is a synthetic benzylamine antifungal, inhibiting the synthesis of sterols by inhibiting squalene epoxidase. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
