You have no items in your shopping cart.
Cart summary
Boeravinone B
Catalog Number: orb1681263
| Catalog Number | orb1681263 |
|---|---|
| Category | Small Molecules |
| Description | Boeravinone B |
| CAS Number | 114567-34-9 |
| Purity | 98% |
| MW | 312.27 |
| SMILES | Cc1c(O)cc2oc3C(O)Oc4ccccc4-c3c(=O)c2c1O |
| Formula | C17H12O6 |
| Biological Activity | Boeravinone B, a novel efflux pump inhibitor, apart from inhibiting the MdeA mediated efflux, also significantly inhibit the biofilm formation of S. aureus, boeravinone B may be used in combination with mupirocin for further development. Boeravinone B exhibits significant anti-inflammatory activity (56.6% at 50 mg/kg) when evaluated in an in vivo carrageenan-induced rat paw model. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
