You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb691998 |
---|---|
Category | Small Molecules |
Description | BLT-1 is an irreversible Scavenger receptor class B member I (SR-BI) inhibitor that blocks SR-BI-mediated selective lipid uptake and bidirectional cholesterol flux with an IC50 of 50 nM; significantly inhibits baicalin-induced cholesterol efflux in THP-1 macrophages. |
CAS Number | [321673-30-7] |
MW | 241.396 |
SMILES | C1(/C(CCCCCC)CCC/1)=N/NC(=S)N |
Formula | C12H23N3S |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
IHC, IHC-Fr, IHC-P | |
Equine, Hamster, Human, Monkey, Mouse, Rabbit, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
IHC, IHC-P | |
Human | |
Rabbit | |
Polyclonal | |
Unconjugated |
IHC, IHC-P | |
Human | |
Rabbit | |
Polyclonal | |
Unconjugated |
IHC, IHC-P | |
Human, Monkey | |
Rabbit | |
Polyclonal | |
Unconjugated |
98.30% | |
321673-30-7 | |
241.4 | |
C12H23N3S |