You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb104913 |
---|---|
Category | Small Molecules |
Description | beta-Carotene |
CAS Number | [7235-40-7] |
Purity | > 98%,Standard References |
MW | 536.87 |
SMILES | CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C=C/C2=C(CCCC2(C)C)C)\C)\C)/C)/C |
Formula | C40H56 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
Chemical structure of beta-Carotene
WB | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
WB | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |