You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb611512 |
---|---|
Category | Small Molecules |
Description | A potent HDAC inhibitor with IC50 of 27 nM (HeLa cell extracts). |
CAS Number | [866323-14-0] |
MW | 318.3477 |
SMILES | ONC(=O)/C=C/C1C=CC=C(S(NC2C=CC=CC=2)(=O)=O)C=1 |
Formula | C15H14N2O4S |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
100% | |
866323-14-0 | |
318.35 | |
C15H14N2O4S |
99.93% | |
414864-00-9 | |
318.35 | |
C15H14N2O4S |
[414864-00-9] | |
318.3477 | |
C15H14N2O4S |