You have no items in your shopping cart.
Cart summary
AVN-492
Catalog Number: orb1302022
| Catalog Number | orb1302022 |
|---|---|
| Category | Small Molecules |
| Description | AVN-492 |
| CAS Number | 1220646-23-0 |
| Purity | 99.29% |
| MW | 359.45 |
| SMILES | CNc1nn2c(C)c(N(C)C)c(C)nc2c1S(=O)(=O)c1ccccc1 |
| Formula | C17H21N5O2S |
| Biological Activity | AVN-49 is a potent and selective 5-HT6R Antagonist (Ki: 91 pM). |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
