You have no items in your shopping cart.
Cart summary
AT-56
Catalog Number: orb1307297
| Catalog Number | orb1307297 |
|---|---|
| Category | Small Molecules |
| Description | AT-56 |
| CAS Number | 162640-98-4 |
| Purity | 98.16% |
| MW | 397.52 |
| SMILES | C(CCc1nn[nH]n1)CN1CCC(CC1)=C1c2ccccc2C=Cc2ccccc12 |
| Formula | C25H27N5 |
| Biological Activity | AT56, a specific inhibitor of prostaglandin D2 synthase enzymatic activity, blunted adipogenic aldosterone effects. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
