You have no items in your shopping cart.
Cart summary
AS-604850
Catalog Number: orb1300806
| Catalog Number | orb1300806 |
|---|---|
| Category | Small Molecules |
| Description | AS-604850 |
| CAS Number | 648449-76-7 |
| Purity | 99.84% |
| MW | 285.22 |
| SMILES | FC1(F)Oc2ccc(\C=C3/SC(=O)NC3=O)cc2O1 |
| Formula | C11H5F2NO4S |
| Biological Activity | AS-604850 is a specific and ATP-competitive PI3Kγ inhibitor (IC50: 250 nM), 18-fold more selective for PI3Kγ than PI3Kα, and over 80-fold selectivity for PI3Kγ than PI3Kδ/β. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
