You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1710747 |
---|---|
Category | Small Molecules |
Description | Argatroban |
CAS Number | 74863-84-6 |
Purity | 99.77% |
MW | 508.63 |
SMILES | S(N[C@H](C(=O)N1[C@@H](C(O)=O)C[C@H](C)CC1)CCCNC(=N)N)(=O)(=O)C2=C3C(=CC=C2)CC(C)CN3 |
Formula | C23H36N6O5S |
Biological Activity | Argatroban (MCI-9038), a specific thrombin inhibitor, which is a non-heparin anticoagulant, prevents the formation of thrombi. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
100% | |
141396-28-3 | |
526.65 | |
C23H38N6O6S |