You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb134634 |
---|---|
Category | Small Molecules |
Description | Argatroban |
CAS Number | [74863-84-6] |
MW | 508.63 |
SMILES | O=C([C@@H]1N(C([C@@H](NS(=O)(C2=CC=CC3=C2NCC(C)C3)=O)CCCNC(N)=N)=O)CC[C@@H](C)C1)O |
Formula | C23H36N6O5S |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
100% | |
141396-28-3 | |
526.65 | |
C23H38N6O6S |
99.77% | |
74863-84-6 | |
508.63 | |
C23H36N6O5S |