You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb611499 |
---|---|
Category | Small Molecules |
Description | An antibiotic that inhibits eukaryotic protein synthesis by inhibiting peptidyl transferase or the 80S ribosome system. |
CAS Number | [22862-76-6] |
MW | 265.305 |
SMILES | O(C(C([H])([H])[H])=O)[C@]1([H])[C@]([H])(C([H])([H])N([H])[C@]1([H])C([H])([H])C1C([H])=C([H])C(=C([H])C=1[H])OC([H])([H])[H])O[H] |
Formula | C14H19NO4 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
ICC, IHC, IP, WB | |
Bovine, Canine, Gallus, Guinea pig, Hamster, Human, Monkey, Mouse, Porcine, Rabbit, Rat, Sheep | |
Rabbit | |
Polyclonal | |
APC |
ICC, IHC, IP, WB | |
Bovine, Canine, Gallus, Guinea pig, Hamster, Human, Monkey, Mouse, Porcine, Rabbit, Rat, Sheep | |
Rabbit | |
Polyclonal | |
Biotin |
ICC, IHC, IP, WB | |
Bovine, Canine, Gallus, Guinea pig, Hamster, Human, Monkey, Mouse, Porcine, Rabbit, Rat, Sheep | |
Rabbit | |
Polyclonal | |
FITC |
Filter by Rating