You have no items in your shopping cart.
Cart summary
β-Anhydroicaritin
Catalog Number: orb1300166
| Catalog Number | orb1300166 |
|---|---|
| Category | Small Molecules |
| Description | β-Anhydroicaritin |
| CAS Number | 38226-86-7 |
| Purity | 96.95% |
| MW | 368.38 |
| SMILES | COc1ccc(cc1)-c1oc2c3CCC(C)(C)Oc3cc(O)c2c(=O)c1O |
| Formula | C21H20O6 |
| Biological Activity | 1. β-Anhydroicaritin exhibits immunosuppressive effect on the mouse macrophages stimulated by LPS. 2. β-Anhydroicaritin phytosomes can inhibit enhanced bone turnover induced by ovariectomy, improve BMD the biomechanical properties of vertebrae, without any stimulation on uterus. 3. β-Anhydroicaritin possesses significant protective effects on the zymosan-induced peritonitis mice, which might be associated with the regulation of Ca(2+); influx in macrophages and iNOS expression. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
