You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb105897 |
---|---|
Category | Small Molecules |
Description | Alisol B |
CAS Number | [18649-93-9] |
Purity | > 98%,Standard References |
MW | 444.65 |
SMILES | O=C1C[C@@]2([H])[C@@](CC1)(C)[C@@]3([H])[C@@](CC2)(C)[C@]4(C)C(C[C@@H]3O)=C([C@H](C)C[C@H](O)[C@]5([H])OC5(C)C)CC4 |
Formula | C28H44O4 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.87% | |
26575-95-1 | |
514.74 | |
C32H50O5 |
98.00% | |
18649-93-9 | |
472.7 | |
C30H48O4 |