You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1306046 |
---|---|
Category | Small Molecules |
Description | Alflutinib |
CAS Number | 1869057-83-9 |
Purity | 99.61% |
MW | 568.59 |
SMILES | CN1C=C(C=2C1=CC=CC2)C3=NC(NC4=C(OCC(F)(F)F)N=C(N(CCN(C)C)C)C(NC(C=C)=O)=C4)=NC=C3 |
Formula | C28H31F3N8O2 |
Biological Activity | Alflutinib (ASK120067) is an inhibitor of EGFR, and its targets including EGFR activating mutations and T790M, thus leading to tumor growth inhibition. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.81% | |
2130958-55-1 | |
664.7 | |
C29H35F3N8O5S |
[2130958-55-1] | |
664.7 | |
C29H35F3N8O5S |
[1869057-83-9] | |
568.605 | |
C28H31F3N8O2 |