You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb654685 |
---|---|
Category | Small Molecules |
Description | Adenosine Amine Congener is shown to be an aqueous-soluble Adenosine A1-R agonist. |
CAS Number | [96760-69-9] |
MW | 576.6 |
SMILES | C1=CC(=CC(=C1)NC(=O)CC2=CC=C(C=C2)NC3=NC=NC4=C3N=CN4[C@H]5[C@@H]([C@@H]([C@H](O5)CO)O)O)CC(=O)NCCN |
Formula | C28H32N8O6 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
[96865-92-8] | |
428.5 | |
C21H28N6O4 |
97.85% | |
2459963-12-1 | |
464.95 | |
C21H31Cl3N6O4 |
98.29% | |
96760-69-9 | |
576.6 | |
C28H32N8O6 |
Filter by Rating