You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb180776 |
---|---|
Category | Small Molecules |
Description | Adefovir Dipivoxil(Preveon, Hepsera) works by blocking reverse transcriptase, an enzyme that is crucial for the hepatitis B virus (HBV) to reproduce in the body. |
CAS Number | [142340-99-6] |
MW | 501.47 |
SMILES | NC1=NC=NC2=C1N=CN2CCOCP(OCOC(C(C)(C)C)=O)(OCOC(C(C)(C)C)=O)=O |
Formula | C20H32N5O8P |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
Chemical structure of Adefovir Dipivoxil
98% | |
142340-99-6 | |
501.47 | |
C20H32N5O8P |