You have no items in your shopping cart.
Cart summary
Acetylcholine chloride
Catalog Number: orb1309343
| Catalog Number | orb1309343 |
|---|---|
| Category | Small Molecules |
| Description | Acetylcholine chloride |
| CAS Number | 60-31-1 |
| Purity | 98.00% |
| MW | 181.66 |
| SMILES | [Cl-].CC(=O)OCC[N+](C)(C)C |
| Formula | C7H16ClNO2 |
| Biological Activity | Acetylcholine Chloride is the chloride salt form of acetylcholine, a synthetic, quaternary amino alcohol with cholinergic properties. Acetylcholine chloride (Pilofrin) mimics the parasympathomimetic effect of the endogenous compound acetylcholine. Administered as an ophthalmic solution, this drug stimulates the cholinoceptors in the sphincter muscle of the iris, causing the pupil to constrict. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
