You have no items in your shopping cart.
Cart summary
A-381393
Catalog Number: orb1301824
| Catalog Number | orb1301824 |
|---|---|
| Category | Small Molecules |
| Description | A-381393 |
| CAS Number | 726174-00-1 |
| Purity | 99.92% |
| MW | 320.43 |
| SMILES | Cc1ccc(cc1C)N1CCN(Cc2nc3ccccc3[nH]2)CC1 |
| Formula | C20H24N4 |
| Biological Activity | A-381393 is a selective and brain penetrate dopamine D4 receptor antagonist (Kis: 1.9/1.5/1.6 nM for human dopamine D4.2/D4.4/D4.7 receptor). |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
