You have no items in your shopping cart.
Cart summary
6-Gingerdiol
Catalog Number: orb1984103
| Catalog Number | orb1984103 |
|---|---|
| Category | Small Molecules |
| Description | 6-Gingerdiol is a natural product. |
| CAS Number | 53318-09-5 |
| Purity | 98.00% |
| MW | 296.4 |
| SMILES | C(C[C@@H](C[C@@H](CCCCC)O)O)C1=CC(OC)=C(O)C=C1 |
| Formula | C17H28O4 |
| Biological Activity | 6-Gingerdiol is a natural product. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
